C22H18N4O2S — CID 67890762
N-[4-[2-(2-methoxyphenoxy)-1,3-thiazol-4-yl]but-3-ynyl]quinazolin-4-amine (PubChem CID 67890762) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyphenoxy)-1,3-thiazol-4-yl]but-3-ynyl]quinazolin-4-amine.
| Compound Name | N-[4-[2-(2-methoxyphenoxy)-1,3-thiazol-4-yl]but-3-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67890762 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[4-[2-(2-methoxyphenoxy)-1,3-thiazol-4-yl]but-3-ynyl]quinazolin-4-amine |
| SMILES | COc1ccccc1Oc1nc(C#CCCNc2ncnc3ccccc23)cs1 |
| InChI | InChI=1S/C22H18N4O2S/c1-27-19-11-4-5-12-20(19)28-22-26-16(14-29-22)8-6-7-13-23-21-17-9-2-3-10-18(17)24-15-25-21/h2-5,9-12,14-15H,7,13H2,1H3,(H,23,24,25) |
| InChIKey | ZDYWIDHKKWBMKH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|