C22H15N5OS — CID 67610155
2-[[4-[4-(quinazolin-4-ylamino)but-1-ynyl]-1,3-thiazol-2-yl]oxy]benzonitrile (PubChem CID 67610155) has the molecular formula C22H15N5OS and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[[4-[4-(quinazolin-4-ylamino)but-1-ynyl]-1,3-thiazol-2-yl]oxy]benzonitrile.
| Compound Name | 2-[[4-[4-(quinazolin-4-ylamino)but-1-ynyl]-1,3-thiazol-2-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 67610155 |
| Molecular Formula | C22H15N5OS |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[[4-[4-(quinazolin-4-ylamino)but-1-ynyl]-1,3-thiazol-2-yl]oxy]benzonitrile |
| SMILES | N#Cc1ccccc1Oc1nc(C#CCCNc2ncnc3ccccc23)cs1 |
| InChI | InChI=1S/C22H15N5OS/c23-13-16-7-1-4-11-20(16)28-22-27-17(14-29-22)8-5-6-12-24-21-18-9-2-3-10-19(18)25-15-26-21/h1-4,7,9-11,14-15H,6,12H2,(H,24,25,26) |
| InChIKey | ORCATPKZRARION-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|