C16H14N6 — CID 53498953
2-[2-(quinazolin-4-ylamino)ethylamino]pyridine-3-carbonitrile (PubChem CID 53498953) has the molecular formula C16H14N6 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[2-(quinazolin-4-ylamino)ethylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(quinazolin-4-ylamino)ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 53498953 |
| Molecular Formula | C16H14N6 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[2-(quinazolin-4-ylamino)ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCCNc1ncnc2ccccc12 |
| InChI | InChI=1S/C16H14N6/c17-10-12-4-3-7-18-15(12)19-8-9-20-16-13-5-1-2-6-14(13)21-11-22-16/h1-7,11H,8-9H2,(H,18,19)(H,20,21,22) |
| InChIKey | KTEZWOIUXUQRDS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|