C24H22F4N2O — CID 67894019
2-[3-fluoro-5-prop-2-enyl-4-(2,2,2-trifluoro-1-phenylethoxy)phenyl]-5-propylpyrimidine (PubChem CID 67894019) has the molecular formula C24H22F4N2O and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-[3-fluoro-5-prop-2-enyl-4-(2,2,2-trifluoro-1-phenylethoxy)phenyl]-5-propylpyrimidine.
| Compound Name | 2-[3-fluoro-5-prop-2-enyl-4-(2,2,2-trifluoro-1-phenylethoxy)phenyl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 67894019 |
| Molecular Formula | C24H22F4N2O |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[3-fluoro-5-prop-2-enyl-4-(2,2,2-trifluoro-1-phenylethoxy)phenyl]-5-propylpyrimidine |
| SMILES | C=CCc1cc(-c2ncc(CCC)cn2)cc(F)c1OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H22F4N2O/c1-3-8-16-14-29-23(30-15-16)19-12-18(9-4-2)21(20(25)13-19)31-22(24(26,27)28)17-10-6-5-7-11-17/h4-7,10-15,22H,2-3,8-9H2,1H3 |
| InChIKey | ACZPINOIFBSFGO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|