(5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate

C10H18O5 — CID 67894107

IUPAC(5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate
SMILESCCCC1OCC(CC)(OC(=O)O)CO1
InChIInChI=1S/C10H18O5/c1-3-5-8-13-6-10(4-2,7-14-8)15-9(11)12/h8H,3-7H2,1-2H3,(H,11,12)
InChIKeyDKCFSVXPWCHNLN-UHFFFAOYSA-N
MW218.25 g/mol
LogP2.00
Rot. Bonds4

About (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate

(5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate (PubChem CID 67894107) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate.

Molecular Properties

Compound Name(5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate
PubChem CID67894107
Molecular FormulaC10H18O5
Molecular Weight218.25 g/mol
Exact Mass218.12
IUPAC Name(5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate
SMILESCCCC1OCC(CC)(OC(=O)O)CO1
InChIInChI=1S/C10H18O5/c1-3-5-8-13-6-10(4-2,7-14-8)15-9(11)12/h8H,3-7H2,1-2H3,(H,11,12)
InChIKeyDKCFSVXPWCHNLN-UHFFFAOYSA-N
XLogP2.00
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate?
The IUPAC name of (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate (CID 67894107) is (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate.
What is the SMILES notation for (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate?
The canonical SMILES for (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate is CCCC1OCC(CC)(OC(=O)O)CO1.
What is the InChIKey of (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate?
The InChIKey is DKCFSVXPWCHNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-3-5-8-13-6-10(4-2,7-14-8)15-9(11)12/h8H,3-7H2,1-2H3,(H,11,12).
What are the key properties of (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate?
(5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate has a molecular weight of 218.25 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-propyl-1,3-dioxan-5-yl) hydrogen carbonate is sourced from PubChem (CID 67894107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).