C10H20O4 — CID 139206521
(2S,4R,5R)-2-tert-butyl-4-methoxy-5-methyl-1,3-dioxan-5-ol (PubChem CID 139206521) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,4R,5R)-2-tert-butyl-4-methoxy-5-methyl-1,3-dioxan-5-ol.
| Compound Name | (2S,4R,5R)-2-tert-butyl-4-methoxy-5-methyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 139206521 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2S,4R,5R)-2-tert-butyl-4-methoxy-5-methyl-1,3-dioxan-5-ol |
| SMILES | CO[C@@H]1O[C@@H](C(C)(C)C)OC[C@@]1(C)O |
| InChI | InChI=1S/C10H20O4/c1-9(2,3)7-13-6-10(4,11)8(12-5)14-7/h7-8,11H,6H2,1-5H3/t7-,8+,10+/m0/s1 |
| InChIKey | AMBPPAFCUIGGRE-QXFUBDJGSA-N |
| XLogP | 1.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |