C15H21N — CID 67896965
1-methylidene-2-pentyl-3,4-dihydroisoquinoline (PubChem CID 67896965) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-methylidene-2-pentyl-3,4-dihydroisoquinoline.
| Compound Name | 1-methylidene-2-pentyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 67896965 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-methylidene-2-pentyl-3,4-dihydroisoquinoline |
| SMILES | C=C1c2ccccc2CCN1CCCCC |
| InChI | InChI=1S/C15H21N/c1-3-4-7-11-16-12-10-14-8-5-6-9-15(14)13(16)2/h5-6,8-9H,2-4,7,10-12H2,1H3 |
| InChIKey | FGFZSODCUOPXOD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|