About N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide
N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide (PubChem CID 67897681) has the molecular formula C26H29N3O6S
and a molecular weight of 511.60 g/mol. Its IUPAC name is N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide |
| PubChem CID | 67897681 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide |
| SMILES | CCCCCCOc1ccc(N(NC(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H29N3O6S/c1-3-4-5-6-19-35-24-15-11-22(12-16-24)28(27-26(30)21-9-7-20(2)8-10-21)36(33,34)25-17-13-23(14-18-25)29(31)32/h7-18H,3-6,19H2,1-2H3,(H,27,30) |
| InChIKey | DZDDRQQHWSYIML-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide?
The IUPAC name of N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide (CID 67897681) is N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide.
What is the SMILES notation for N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide?
The canonical SMILES for N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide is CCCCCCOc1ccc(N(NC(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide?
The InChIKey is DZDDRQQHWSYIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N3O6S/c1-3-4-5-6-19-35-24-15-11-22(12-16-24)28(27-26(30)21-9-7-20(2)8-10-21)36(33,34)25-17-13-23(14-18-25)29(31)32/h7-18H,3-6,19H2,1-2H3,(H,27,30).
What are the key properties of N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide?
N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide has a molecular weight of 511.60 g/mol, XLogP of 5.40, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-hexoxyphenyl)-4-methyl-N'-(4-nitrophenyl)sulfonylbenzohydrazide is sourced from PubChem (CID 67897681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).