C45H87N9 — CID 67898474
2-N,4-N,6-N-tris(3,3-dimethylpentan-2-yl)-2-N,4-N,6-N-tris(2,2-dimethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 67898474) has the molecular formula C45H87N9 and a molecular weight of 754.25 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(3,3-dimethylpentan-2-yl)-2-N,4-N,6-N-tris(2,2-dimethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(3,3-dimethylpentan-2-yl)-2-N,4-N,6-N-tris(2,2-dimethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 67898474 |
| Molecular Formula | C45H87N9 |
| Molecular Weight | 754.25 g/mol |
| Exact Mass | 753.71 |
| IUPAC Name | 2-N,4-N,6-N-tris(3,3-dimethylpentan-2-yl)-2-N,4-N,6-N-tris(2,2-dimethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCC(C)(C)C(C)N(c1nc(N(C2CCNC(C)(C)C2)C(C)C(C)(C)CC)nc(N(C2CCNC(C)(C)C2)C(C)C(C)(C)CC)n1)C1CCNC(C)(C)C1 |
| InChI | InChI=1S/C45H87N9/c1-19-40(7,8)31(4)52(34-22-25-46-43(13,14)28-34)37-49-38(53(32(5)41(9,10)20-2)35-23-26-47-44(15,16)29-35)51-39(50-37)54(33(6)42(11,12)21-3)36-24-27-48-45(17,18)30-36/h31-36,46-48H,19-30H2,1-18H3 |
| InChIKey | RAXMPAYHQKPIFI-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.25 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |