C45H87N9O3 — CID 67898350
4-[[4,6-bis[(2,2-dimethylpiperidin-4-yl)-(5-hydroxy-2-methylhexan-3-yl)amino]-1,3,5-triazin-2-yl]-(2,2-dimethylpiperidin-4-yl)amino]-5-methylhexan-2-ol (PubChem CID 67898350) has the molecular formula C45H87N9O3 and a molecular weight of 802.25 g/mol. Its IUPAC name is 4-[[4,6-bis[(2,2-dimethylpiperidin-4-yl)-(5-hydroxy-2-methylhexan-3-yl)amino]-1,3,5-triazin-2-yl]-(2,2-dimethylpiperidin-4-yl)amino]-5-methylhexan-2-ol.
| Compound Name | 4-[[4,6-bis[(2,2-dimethylpiperidin-4-yl)-(5-hydroxy-2-methylhexan-3-yl)amino]-1,3,5-triazin-2-yl]-(2,2-dimethylpiperidin-4-yl)amino]-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 67898350 |
| Molecular Formula | C45H87N9O3 |
| Molecular Weight | 802.25 g/mol |
| Exact Mass | 801.69 |
| IUPAC Name | 4-[[4,6-bis[(2,2-dimethylpiperidin-4-yl)-(5-hydroxy-2-methylhexan-3-yl)amino]-1,3,5-triazin-2-yl]-(2,2-dimethylpiperidin-4-yl)amino]-5-methylhexan-2-ol |
| SMILES | CC(O)CC(C(C)C)N(c1nc(N(C2CCNC(C)(C)C2)C(CC(C)O)C(C)C)nc(N(C2CCNC(C)(C)C2)C(CC(C)O)C(C)C)n1)C1CCNC(C)(C)C1 |
| InChI | InChI=1S/C45H87N9O3/c1-28(2)37(22-31(7)55)52(34-16-19-46-43(10,11)25-34)40-49-41(53(38(29(3)4)23-32(8)56)35-17-20-47-44(12,13)26-35)51-42(50-40)54(39(30(5)6)24-33(9)57)36-18-21-48-45(14,15)27-36/h28-39,46-48,55-57H,16-27H2,1-15H3 |
| InChIKey | YJPSUPQILVFIIM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.25 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |