C28H39FO3 — CID 67899443
4-[2-(3-fluoro-4-octoxyphenyl)phenyl]octanoic acid (PubChem CID 67899443) has the molecular formula C28H39FO3 and a molecular weight of 442.62 g/mol. Its IUPAC name is 4-[2-(3-fluoro-4-octoxyphenyl)phenyl]octanoic acid.
| Compound Name | 4-[2-(3-fluoro-4-octoxyphenyl)phenyl]octanoic acid |
|---|---|
| PubChem CID | 67899443 |
| Molecular Formula | C28H39FO3 |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 4-[2-(3-fluoro-4-octoxyphenyl)phenyl]octanoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccccc2C(CCCC)CCC(=O)O)cc1F |
| InChI | InChI=1S/C28H39FO3/c1-3-5-7-8-9-12-20-32-27-18-16-23(21-26(27)29)25-15-11-10-14-24(25)22(13-6-4-2)17-19-28(30)31/h10-11,14-16,18,21-22H,3-9,12-13,17,19-20H2,1-2H3,(H,30,31) |
| InChIKey | OKLDMGFMQPHYNM-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|