C20H14Cl4O5 — CID 67899790
2-[(2,4-dichlorobenzoyl)oxy-(2,4-dichloro-3-ethylphenyl)methylidene]-3-oxobutanoic acid (PubChem CID 67899790) has the molecular formula C20H14Cl4O5 and a molecular weight of 476.14 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)oxy-(2,4-dichloro-3-ethylphenyl)methylidene]-3-oxobutanoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)oxy-(2,4-dichloro-3-ethylphenyl)methylidene]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 67899790 |
| Molecular Formula | C20H14Cl4O5 |
| Molecular Weight | 476.14 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)oxy-(2,4-dichloro-3-ethylphenyl)methylidene]-3-oxobutanoic acid |
| SMILES | CCc1c(Cl)ccc(C(OC(=O)c2ccc(Cl)cc2Cl)=C(C(C)=O)C(=O)O)c1Cl |
| InChI | InChI=1S/C20H14Cl4O5/c1-3-11-14(22)7-6-13(17(11)24)18(16(9(2)25)19(26)27)29-20(28)12-5-4-10(21)8-15(12)23/h4-8H,3H2,1-2H3,(H,26,27) |
| InChIKey | OWRHSNYTAYUPFN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.14 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|