C15H14Cl2N2O2 — CID 70341606
(5-cyclopropyl-4-ethyl-1H-pyrazol-3-yl) 2,4-dichlorobenzoate (PubChem CID 70341606) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.19 g/mol. Its IUPAC name is (5-cyclopropyl-4-ethyl-1H-pyrazol-3-yl) 2,4-dichlorobenzoate.
| Compound Name | (5-cyclopropyl-4-ethyl-1H-pyrazol-3-yl) 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 70341606 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (5-cyclopropyl-4-ethyl-1H-pyrazol-3-yl) 2,4-dichlorobenzoate |
| SMILES | CCc1c(OC(=O)c2ccc(Cl)cc2Cl)n[nH]c1C1CC1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-2-10-13(8-3-4-8)18-19-14(10)21-15(20)11-6-5-9(16)7-12(11)17/h5-8H,2-4H2,1H3,(H,18,19) |
| InChIKey | CGUAGORZMKLVLJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |