C12H12ClNO4 — CID 67900266
2-[(E)-3-(5-amino-2-chlorophenyl)prop-2-enyl]propanedioic acid (PubChem CID 67900266) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 2-[(E)-3-(5-amino-2-chlorophenyl)prop-2-enyl]propanedioic acid.
| Compound Name | 2-[(E)-3-(5-amino-2-chlorophenyl)prop-2-enyl]propanedioic acid |
|---|---|
| PubChem CID | 67900266 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-[(E)-3-(5-amino-2-chlorophenyl)prop-2-enyl]propanedioic acid |
| SMILES | Nc1ccc(Cl)c(/C=C/CC(C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C12H12ClNO4/c13-10-5-4-8(14)6-7(10)2-1-3-9(11(15)16)12(17)18/h1-2,4-6,9H,3,14H2,(H,15,16)(H,17,18)/b2-1+ |
| InChIKey | XCBHXGVRWYDKGF-OWOJBTEDSA-N |
| XLogP | 2.11 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|