C15H13N5O3 — CID 67900676
ethyl 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaen-5-yl carbonate (PubChem CID 67900676) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is ethyl 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaen-5-yl carbonate.
| Compound Name | ethyl 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaen-5-yl carbonate |
|---|---|
| PubChem CID | 67900676 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | ethyl 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaen-5-yl carbonate |
| SMILES | CCOC(=O)Oc1ncn2c1Cn1ncnc1-c1ccccc1-2 |
| InChI | InChI=1S/C15H13N5O3/c1-2-22-15(21)23-14-12-7-20-13(16-8-18-20)10-5-3-4-6-11(10)19(12)9-17-14/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | QUEYGVKXNIHAEL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |