About imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane
imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane (PubChem CID 67904105) has the molecular formula C34H37BN2Si
and a molecular weight of 512.58 g/mol. Its IUPAC name is imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane.
Molecular Properties
| Compound Name | imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane |
| PubChem CID | 67904105 |
| Molecular Formula | C34H37BN2Si |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane |
| SMILES | CB(c1ccccc1)c1ccccc1.CCCC=C[Si](Cn1ccnc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2Si.C13H13B/c1-2-3-10-17-24(19-23-16-15-22-18-23,20-11-6-4-7-12-20)21-13-8-5-9-14-21;1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h4-18H,2-3,19H2,1H3;2-11H,1H3 |
| InChIKey | CEZDCFAFFFWVBS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane?
The IUPAC name of imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane (CID 67904105) is imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane.
What is the SMILES notation for imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane?
The canonical SMILES for imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane is CB(c1ccccc1)c1ccccc1.CCCC=C[Si](Cn1ccnc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane?
The InChIKey is CEZDCFAFFFWVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2Si.C13H13B/c1-2-3-10-17-24(19-23-16-15-22-18-23,20-11-6-4-7-12-20)21-13-8-5-9-14-21;1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h4-18H,2-3,19H2,1H3;2-11H,1H3.
What are the key properties of imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane?
imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane has a molecular weight of 512.58 g/mol, XLogP of 5.51, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imidazol-1-ylmethyl-pent-1-enyl-diphenylsilane;methyl(diphenyl)borane is sourced from PubChem (CID 67904105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).