C23H32N2O6 — CID 67905338
2-ethylhexyl 3-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]propanoate (PubChem CID 67905338) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-ethylhexyl 3-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]propanoate.
| Compound Name | 2-ethylhexyl 3-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 67905338 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-ethylhexyl 3-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]propanoate |
| SMILES | CCCCC(CC)COC(=O)CCN1C(=O)N/C(=C/c2cccc(OC)c2OC)C1=O |
| InChI | InChI=1S/C23H32N2O6/c1-5-7-9-16(6-2)15-31-20(26)12-13-25-22(27)18(24-23(25)28)14-17-10-8-11-19(29-3)21(17)30-4/h8,10-11,14,16H,5-7,9,12-13,15H2,1-4H3,(H,24,28)/b18-14+ |
| InChIKey | KCJVQLZXYBDMEU-NBVRZTHBSA-N |
| XLogP | 3.75 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|