C18H23NO8 — CID 67907903
ethyl 5-acetyl-2,4-bis(2-ethoxy-2-oxoethyl)-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 67907903) has the molecular formula C18H23NO8 and a molecular weight of 381.38 g/mol. Its IUPAC name is ethyl 5-acetyl-2,4-bis(2-ethoxy-2-oxoethyl)-6-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2,4-bis(2-ethoxy-2-oxoethyl)-6-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67907903 |
| Molecular Formula | C18H23NO8 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | ethyl 5-acetyl-2,4-bis(2-ethoxy-2-oxoethyl)-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)Cc1[nH]c(=O)c(C(C)=O)c(CC(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C18H23NO8/c1-5-25-13(21)8-11-15(10(4)20)17(23)19-12(9-14(22)26-6-2)16(11)18(24)27-7-3/h5-9H2,1-4H3,(H,19,23) |
| InChIKey | XQXHPKYNZKTFTG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|