C8H10N2O4S — CID 86601098
ethyl 2-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate (PubChem CID 86601098) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is ethyl 2-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate.
| Compound Name | ethyl 2-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate |
|---|---|
| PubChem CID | 86601098 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | ethyl 2-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate |
| SMILES | CCOC(=O)Cc1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O4S/c1-2-14-5(11)3-4-6(12)9-8(15)10-7(4)13/h2-3H2,1H3,(H3,9,10,12,13,15) |
| InChIKey | QMDGQZXVZKYDBN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|