C16H10F3N3O4S — CID 67909877
N-(benzenesulfonyl)-3-oxo-7-(trifluoromethyl)-4H-quinoxaline-2-carboxamide (PubChem CID 67909877) has the molecular formula C16H10F3N3O4S and a molecular weight of 397.33 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3-oxo-7-(trifluoromethyl)-4H-quinoxaline-2-carboxamide.
| Compound Name | N-(benzenesulfonyl)-3-oxo-7-(trifluoromethyl)-4H-quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 67909877 |
| Molecular Formula | C16H10F3N3O4S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-(benzenesulfonyl)-3-oxo-7-(trifluoromethyl)-4H-quinoxaline-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1nc2cc(C(F)(F)F)ccc2[nH]c1=O |
| InChI | InChI=1S/C16H10F3N3O4S/c17-16(18,19)9-6-7-11-12(8-9)20-13(14(23)21-11)15(24)22-27(25,26)10-4-2-1-3-5-10/h1-8H,(H,21,23)(H,22,24) |
| InChIKey | YJNCMLBUZSFFDK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |