About 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline
9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline (PubChem CID 67910684) has the molecular formula C18H16BrN3
and a molecular weight of 354.25 g/mol. Its IUPAC name is 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline |
| PubChem CID | 67910684 |
| Molecular Formula | C18H16BrN3 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline |
| SMILES | CCn1c2ccc(Br)cc2c2nc3cc(C)c(C)cc3nc21 |
| InChI | InChI=1S/C18H16BrN3/c1-4-22-16-6-5-12(19)9-13(16)17-18(22)21-15-8-11(3)10(2)7-14(15)20-17/h5-9H,4H2,1-3H3 |
| InChIKey | DGBSXLWXOWVXFT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline?
The IUPAC name of 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline (CID 67910684) is 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline.
What is the SMILES notation for 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline?
The canonical SMILES for 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline is CCn1c2ccc(Br)cc2c2nc3cc(C)c(C)cc3nc21.
What is the InChIKey of 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline?
The InChIKey is DGBSXLWXOWVXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN3/c1-4-22-16-6-5-12(19)9-13(16)17-18(22)21-15-8-11(3)10(2)7-14(15)20-17/h5-9H,4H2,1-3H3.
What are the key properties of 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline?
9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline has a molecular weight of 354.25 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-6-ethyl-2,3-dimethylindolo[3,2-b]quinoxaline is sourced from PubChem (CID 67910684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).