About [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate
[2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate (PubChem CID 67916826) has the molecular formula C16H21N3O5S
and a molecular weight of 367.43 g/mol. Its IUPAC name is [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate |
| PubChem CID | 67916826 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate |
| SMILES | CN(C)C(=O)c1cc([N+](=O)[O-])c(S)cc1COC(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H21N3O5S/c1-17(2)15(20)12-9-13(19(22)23)14(25)8-11(12)10-24-16(21)18-6-4-3-5-7-18/h8-9,25H,3-7,10H2,1-2H3 |
| InChIKey | YHYGKBSEFCIXGD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate?
The IUPAC name of [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate (CID 67916826) is [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate.
What is the SMILES notation for [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate?
The canonical SMILES for [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate is CN(C)C(=O)c1cc([N+](=O)[O-])c(S)cc1COC(=O)N1CCCCC1.
What is the InChIKey of [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate?
The InChIKey is YHYGKBSEFCIXGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O5S/c1-17(2)15(20)12-9-13(19(22)23)14(25)8-11(12)10-24-16(21)18-6-4-3-5-7-18/h8-9,25H,3-7,10H2,1-2H3.
What are the key properties of [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate?
[2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate has a molecular weight of 367.43 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylcarbamoyl)-4-nitro-5-sulfanylphenyl]methyl piperidine-1-carboxylate is sourced from PubChem (CID 67916826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).