C16H23N3O5 — CID 175102886
(N-tert-butyl-5-hydroxy-2-nitroanilino) piperidine-1-carboxylate (PubChem CID 175102886) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is (N-tert-butyl-5-hydroxy-2-nitroanilino) piperidine-1-carboxylate.
| Compound Name | (N-tert-butyl-5-hydroxy-2-nitroanilino) piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175102886 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (N-tert-butyl-5-hydroxy-2-nitroanilino) piperidine-1-carboxylate |
| SMILES | CC(C)(C)N(OC(=O)N1CCCCC1)c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)18(24-15(21)17-9-5-4-6-10-17)14-11-12(20)7-8-13(14)19(22)23/h7-8,11,20H,4-6,9-10H2,1-3H3 |
| InChIKey | AGZMQVVIHJISQJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|