C8H14N2O3 — CID 67918001
(2R)-2-[(3S)-3-amino-2-oxoazetidin-1-yl]-3-methylbutanoic acid (PubChem CID 67918001) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-amino-2-oxoazetidin-1-yl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(3S)-3-amino-2-oxoazetidin-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67918001 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2R)-2-[(3S)-3-amino-2-oxoazetidin-1-yl]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)N1C[C@H](N)C1=O |
| InChI | InChI=1S/C8H14N2O3/c1-4(2)6(8(12)13)10-3-5(9)7(10)11/h4-6H,3,9H2,1-2H3,(H,12,13)/t5-,6+/m0/s1 |
| InChIKey | GUABTXNRYMWIEO-NTSWFWBYSA-N |
| XLogP | -0.73 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |