C24H25FN2O4 — CID 67921054
1-[2-fluoro-1,4-bis(phenylmethoxymethyl)cyclobutyl]pyrimidine-2,4-dione (PubChem CID 67921054) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is 1-[2-fluoro-1,4-bis(phenylmethoxymethyl)cyclobutyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-fluoro-1,4-bis(phenylmethoxymethyl)cyclobutyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67921054 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[2-fluoro-1,4-bis(phenylmethoxymethyl)cyclobutyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2(COCc3ccccc3)C(F)CC2COCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H25FN2O4/c25-21-13-20(16-30-14-18-7-3-1-4-8-18)24(21,27-12-11-22(28)26-23(27)29)17-31-15-19-9-5-2-6-10-19/h1-12,20-21H,13-17H2,(H,26,28,29) |
| InChIKey | UWDQAICALBXJQW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |