C22H28O6 — CID 67924644
(E)-6-ethenoxy-6-oxohex-2-enoic acid;prop-2-enyl 4-tert-butylbenzoate (PubChem CID 67924644) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (E)-6-ethenoxy-6-oxohex-2-enoic acid;prop-2-enyl 4-tert-butylbenzoate.
| Compound Name | (E)-6-ethenoxy-6-oxohex-2-enoic acid;prop-2-enyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 67924644 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (E)-6-ethenoxy-6-oxohex-2-enoic acid;prop-2-enyl 4-tert-butylbenzoate |
| SMILES | C=CCOC(=O)c1ccc(C(C)(C)C)cc1.C=COC(=O)CC/C=C/C(=O)O |
| InChI | InChI=1S/C14H18O2.C8H10O4/c1-5-10-16-13(15)11-6-8-12(9-7-11)14(2,3)4;1-2-12-8(11)6-4-3-5-7(9)10/h5-9H,1,10H2,2-4H3;2-3,5H,1,4,6H2,(H,9,10)/b;5-3+ |
| InChIKey | JUXPZKJOVLAZLG-GWDXERMASA-N |
| XLogP | 4.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|