C23H21N3O — CID 67926268
1-[4-[2-(4-methoxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]-N-phenylmethanimine (PubChem CID 67926268) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[4-[2-(4-methoxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]-N-phenylmethanimine.
| Compound Name | 1-[4-[2-(4-methoxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 67926268 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[4-[2-(4-methoxyphenyl)-1,3-dihydropyrazol-5-yl]phenyl]-N-phenylmethanimine |
| SMILES | COc1ccc(N2CC=C(c3ccc(/C=N/c4ccccc4)cc3)N2)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-27-22-13-11-21(12-14-22)26-16-15-23(25-26)19-9-7-18(8-10-19)17-24-20-5-3-2-4-6-20/h2-15,17,25H,16H2,1H3/b24-17+ |
| InChIKey | MHKBFUJNDPCMDU-JJIBRWJFSA-N |
| XLogP | 4.81 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|