C17H16BrN3OS — CID 45156041
(E)-1-(4-methoxyphenyl)-N-(5-phenyl-4H-1,3,4-thiadiazin-2-yl)methanimine;hydrobromide (PubChem CID 45156041) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-N-(5-phenyl-4H-1,3,4-thiadiazin-2-yl)methanimine;hydrobromide.
| Compound Name | (E)-1-(4-methoxyphenyl)-N-(5-phenyl-4H-1,3,4-thiadiazin-2-yl)methanimine;hydrobromide |
|---|---|
| PubChem CID | 45156041 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-N-(5-phenyl-4H-1,3,4-thiadiazin-2-yl)methanimine;hydrobromide |
| SMILES | Br.COc1ccc(/C=N/C2=NNC(c3ccccc3)=CS2)cc1 |
| InChI | InChI=1S/C17H15N3OS.BrH/c1-21-15-9-7-13(8-10-15)11-18-17-20-19-16(12-22-17)14-5-3-2-4-6-14;/h2-12,19H,1H3;1H/b18-11+; |
| InChIKey | CYKFHWYZUZEHSE-NWBUNABESA-N |
| XLogP | 4.30 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|