C34H36BBrN2 — CID 67927141
2-[(4-bromophenyl)methyl]-5-phenyl-1H-imidazole;butyl-bis(2-methylphenyl)borane (PubChem CID 67927141) has the molecular formula C34H36BBrN2 and a molecular weight of 563.39 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-5-phenyl-1H-imidazole;butyl-bis(2-methylphenyl)borane.
| Compound Name | 2-[(4-bromophenyl)methyl]-5-phenyl-1H-imidazole;butyl-bis(2-methylphenyl)borane |
|---|---|
| PubChem CID | 67927141 |
| Molecular Formula | C34H36BBrN2 |
| Molecular Weight | 563.39 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-5-phenyl-1H-imidazole;butyl-bis(2-methylphenyl)borane |
| SMILES | Brc1ccc(Cc2ncc(-c3ccccc3)[nH]2)cc1.CCCCB(c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C18H23B.C16H13BrN2/c1-4-5-14-19(17-12-8-6-10-15(17)2)18-13-9-7-11-16(18)3;17-14-8-6-12(7-9-14)10-16-18-11-15(19-16)13-4-2-1-3-5-13/h6-13H,4-5,14H2,1-3H3;1-9,11H,10H2,(H,18,19) |
| InChIKey | CRVMYYGHSRYJJV-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.39 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|