C22H22N4O8 — CID 67928326
3,5-bis(ethoxycarbonyl)-6-(1H-imidazol-2-ylmethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-2-carboxylic acid (PubChem CID 67928326) has the molecular formula C22H22N4O8 and a molecular weight of 470.44 g/mol. Its IUPAC name is 3,5-bis(ethoxycarbonyl)-6-(1H-imidazol-2-ylmethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-2-carboxylic acid.
| Compound Name | 3,5-bis(ethoxycarbonyl)-6-(1H-imidazol-2-ylmethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 67928326 |
| Molecular Formula | C22H22N4O8 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3,5-bis(ethoxycarbonyl)-6-(1H-imidazol-2-ylmethyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-2-carboxylic acid |
| SMILES | CCOC(=O)C1=C(Cc2ncc[nH]2)NC(C(=O)O)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22N4O8/c1-3-33-21(29)17-14(11-15-23-8-9-24-15)25-19(20(27)28)18(22(30)34-4-2)16(17)12-6-5-7-13(10-12)26(31)32/h5-10,16,25H,3-4,11H2,1-2H3,(H,23,24)(H,27,28) |
| InChIKey | YSAFAPKBCHLXKV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|