C37H34N4O6 — CID 67842742
5-[3-[4-(1H-imidazol-2-ylmethyl)phenyl]-6-phenylhexa-2,5-dienoxy]carbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 67842742) has the molecular formula C37H34N4O6 and a molecular weight of 630.70 g/mol. Its IUPAC name is 5-[3-[4-(1H-imidazol-2-ylmethyl)phenyl]-6-phenylhexa-2,5-dienoxy]carbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[3-[4-(1H-imidazol-2-ylmethyl)phenyl]-6-phenylhexa-2,5-dienoxy]carbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67842742 |
| Molecular Formula | C37H34N4O6 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 5-[3-[4-(1H-imidazol-2-ylmethyl)phenyl]-6-phenylhexa-2,5-dienoxy]carbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC=C(CC=Cc2ccccc2)c2ccc(Cc3ncc[nH]3)cc2)=C(C)N1 |
| InChI | InChI=1S/C37H34N4O6/c1-24-33(36(42)43)35(30-12-7-13-31(23-30)41(45)46)34(25(2)40-24)37(44)47-21-18-28(11-6-10-26-8-4-3-5-9-26)29-16-14-27(15-17-29)22-32-38-19-20-39-32/h3-10,12-20,23,35,40H,11,21-22H2,1-2H3,(H,38,39)(H,42,43) |
| InChIKey | VBYMLUNJBZBWHS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|