C32H29N5O8 — CID 19100144
5-O-(2,5-dioxopyrrolidin-1-yl) 3-O-[(E)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19100144) has the molecular formula C32H29N5O8 and a molecular weight of 611.61 g/mol. Its IUPAC name is 5-O-(2,5-dioxopyrrolidin-1-yl) 3-O-[(E)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2,5-dioxopyrrolidin-1-yl) 3-O-[(E)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19100144 |
| Molecular Formula | C32H29N5O8 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 5-O-(2,5-dioxopyrrolidin-1-yl) 3-O-[(E)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC/C=C/c2ccc(Cc3ncc[nH]3)cc2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)ON2C(=O)CCC2=O)=C(C)N1 |
| InChI | InChI=1S/C32H29N5O8/c1-19-28(31(40)44-16-4-5-21-8-10-22(11-9-21)17-25-33-14-15-34-25)30(23-6-3-7-24(18-23)37(42)43)29(20(2)35-19)32(41)45-36-26(38)12-13-27(36)39/h3-11,14-15,18,30,35H,12-13,16-17H2,1-2H3,(H,33,34)/b5-4+ |
| InChIKey | BTTJBGSDCHCQQF-SNAWJCMRSA-N |
| XLogP | 4.01 |
| TPSA | 173.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|