C21H28O5 — CID 67929551
(1'S,2'S,3'S,6'R)-2'-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67929551) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1'S,2'S,3'S,6'R)-2'-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'S,3'S,6'R)-2'-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67929551 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1'S,2'S,3'S,6'R)-2'-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | C[C@@]12CC[C@H](O)[C@@H](/C=C/[C@H](O)COc3ccccc3)[C@@H]1CC21OCCO1 |
| InChI | InChI=1S/C21H28O5/c1-20-10-9-19(23)17(18(20)13-21(20)25-11-12-26-21)8-7-15(22)14-24-16-5-3-2-4-6-16/h2-8,15,17-19,22-23H,9-14H2,1H3/b8-7+/t15-,17-,18-,19-,20+/m0/s1 |
| InChIKey | GZKKENSUZDZPRA-GIVFWGBKSA-N |
| XLogP | 2.52 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|