C21H29NO4 — CID 67933158
ethyl 2-[4-[(2R)-2-[[(6R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]propyl]phenoxy]acetate (PubChem CID 67933158) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl 2-[4-[(2R)-2-[[(6R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]propyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2R)-2-[[(6R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 67933158 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethyl 2-[4-[(2R)-2-[[(6R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]propyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C[C@@H](C)NC2(O)C=CC=C[C@H]2CC)cc1 |
| InChI | InChI=1S/C21H29NO4/c1-4-18-8-6-7-13-21(18,24)22-16(3)14-17-9-11-19(12-10-17)26-15-20(23)25-5-2/h6-13,16,18,22,24H,4-5,14-15H2,1-3H3/t16-,18-,21?/m1/s1 |
| InChIKey | IFMGBOFKRHFULL-XXTRANHVSA-N |
| XLogP | 2.99 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|