C20H23Cl2N3O5 — CID 57237294
ethyl 2-[4-[2-[[2-(5-amino-4,6-dichloro-2-pyridinyl)-2-hydroxyacetyl]amino]propyl]phenoxy]acetate (PubChem CID 57237294) has the molecular formula C20H23Cl2N3O5 and a molecular weight of 456.33 g/mol. Its IUPAC name is ethyl 2-[4-[2-[[2-(5-amino-4,6-dichloro-2-pyridinyl)-2-hydroxyacetyl]amino]propyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-[[2-(5-amino-4,6-dichloro-2-pyridinyl)-2-hydroxyacetyl]amino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 57237294 |
| Molecular Formula | C20H23Cl2N3O5 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | ethyl 2-[4-[2-[[2-(5-amino-4,6-dichloro-2-pyridinyl)-2-hydroxyacetyl]amino]propyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(CC(C)NC(=O)C(O)c2cc(Cl)c(N)c(Cl)n2)cc1 |
| InChI | InChI=1S/C20H23Cl2N3O5/c1-3-29-16(26)10-30-13-6-4-12(5-7-13)8-11(2)24-20(28)18(27)15-9-14(21)17(23)19(22)25-15/h4-7,9,11,18,27H,3,8,10,23H2,1-2H3,(H,24,28) |
| InChIKey | CKLDUPQEBFOJRF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|