C19H27NO3 — CID 67933184
(6R)-6-ethyl-1-[[(2R)-1-[4-(1-hydroxyethoxy)phenyl]propan-2-yl]amino]cyclohexa-2,4-dien-1-ol (PubChem CID 67933184) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (6R)-6-ethyl-1-[[(2R)-1-[4-(1-hydroxyethoxy)phenyl]propan-2-yl]amino]cyclohexa-2,4-dien-1-ol.
| Compound Name | (6R)-6-ethyl-1-[[(2R)-1-[4-(1-hydroxyethoxy)phenyl]propan-2-yl]amino]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 67933184 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (6R)-6-ethyl-1-[[(2R)-1-[4-(1-hydroxyethoxy)phenyl]propan-2-yl]amino]cyclohexa-2,4-dien-1-ol |
| SMILES | CC[C@@H]1C=CC=CC1(O)N[C@H](C)Cc1ccc(OC(C)O)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-4-17-7-5-6-12-19(17,22)20-14(2)13-16-8-10-18(11-9-16)23-15(3)21/h5-12,14-15,17,20-22H,4,13H2,1-3H3/t14-,15?,17-,19?/m1/s1 |
| InChIKey | LVWREFSWLQOYOY-PSPFXIJKSA-N |
| XLogP | 2.77 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|