C12H21N3O2S — CID 67934504
ethyl 4-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanoate (PubChem CID 67934504) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is ethyl 4-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanoate.
| Compound Name | ethyl 4-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 67934504 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | ethyl 4-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSc1n[nH]c(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N3O2S/c1-5-17-9(16)7-6-8-18-11-13-10(14-15-11)12(2,3)4/h5-8H2,1-4H3,(H,13,14,15) |
| InChIKey | JESPLXFTUCBDHD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|