C35H61BrO2 — CID 67940963
6-bromo-5-[(3S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexanoic acid (PubChem CID 67940963) has the molecular formula C35H61BrO2 and a molecular weight of 593.78 g/mol. Its IUPAC name is 6-bromo-5-[(3S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexanoic acid.
| Compound Name | 6-bromo-5-[(3S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 67940963 |
| Molecular Formula | C35H61BrO2 |
| Molecular Weight | 593.78 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | 6-bromo-5-[(3S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexanoic acid |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](C(CBr)CCCC(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C35H61BrO2/c1-7-25(23(2)3)12-11-24(4)30-15-16-31-29-14-13-28-21-26(27(22-36)9-8-10-33(37)38)17-19-34(28,5)32(29)18-20-35(30,31)6/h23-32H,7-22H2,1-6H3,(H,37,38)/t24-,25-,26+,27?,28?,29+,30-,31+,32+,34+,35-/m1/s1 |
| InChIKey | ZEATUVBYQGLMHJ-GJRGJILLSA-N |
| XLogP | 10.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.78 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|