C8H10FeN2O4 — CID 67948493
2-amino-3-(3-hydroxy-4-oxo-1-pyridinyl)propanoic acid;iron (PubChem CID 67948493) has the molecular formula C8H10FeN2O4 and a molecular weight of 254.02 g/mol. Its IUPAC name is 2-amino-3-(3-hydroxy-4-oxo-1-pyridinyl)propanoic acid;iron.
| Compound Name | 2-amino-3-(3-hydroxy-4-oxo-1-pyridinyl)propanoic acid;iron |
|---|---|
| PubChem CID | 67948493 |
| Molecular Formula | C8H10FeN2O4 |
| Molecular Weight | 254.02 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 2-amino-3-(3-hydroxy-4-oxo-1-pyridinyl)propanoic acid;iron |
| SMILES | NC(Cn1ccc(=O)c(O)c1)C(=O)O.[Fe] |
| InChI | InChI=1S/C8H10N2O4.Fe/c9-5(8(13)14)3-10-2-1-6(11)7(12)4-10;/h1-2,4-5,12H,3,9H2,(H,13,14); |
| InChIKey | RCSGXOUHPMYMFE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.02 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|