C12H17N3O6 — CID 70275385
(2S)-2-amino-3-[3-[(2R)-2-amino-4-hydroxybutanoyl]oxy-4-oxo-1-pyridinyl]propanoic acid (PubChem CID 70275385) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-[(2R)-2-amino-4-hydroxybutanoyl]oxy-4-oxo-1-pyridinyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-[(2R)-2-amino-4-hydroxybutanoyl]oxy-4-oxo-1-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 70275385 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2S)-2-amino-3-[3-[(2R)-2-amino-4-hydroxybutanoyl]oxy-4-oxo-1-pyridinyl]propanoic acid |
| SMILES | N[C@H](CCO)C(=O)Oc1cn(C[C@H](N)C(=O)O)ccc1=O |
| InChI | InChI=1S/C12H17N3O6/c13-7(2-4-16)12(20)21-10-6-15(3-1-9(10)17)5-8(14)11(18)19/h1,3,6-8,16H,2,4-5,13-14H2,(H,18,19)/t7-,8+/m1/s1 |
| InChIKey | ZZCZZWMYNTURML-SFYZADRCSA-N |
| XLogP | -2.12 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |