C23H35NO4 — CID 67952418
(1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-di(propan-2-yl)spiro[1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran-6,2'-oxolane]-9-carboxamide (PubChem CID 67952418) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-di(propan-2-yl)spiro[1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran-6,2'-oxolane]-9-carboxamide.
| Compound Name | (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-di(propan-2-yl)spiro[1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran-6,2'-oxolane]-9-carboxamide |
|---|---|
| PubChem CID | 67952418 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-di(propan-2-yl)spiro[1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran-6,2'-oxolane]-9-carboxamide |
| SMILES | CC(C)N(C(=O)[C@@H]1[C@@H]2[C@@H](C)OC(=O)[C@@H]2C=C2CC3(CCCO3)CC[C@H]21)C(C)C |
| InChI | InChI=1S/C23H35NO4/c1-13(2)24(14(3)4)21(25)20-17-7-9-23(8-6-10-27-23)12-16(17)11-18-19(20)15(5)28-22(18)26/h11,13-15,17-20H,6-10,12H2,1-5H3/t15-,17-,18-,19-,20+,23?/m1/s1 |
| InChIKey | GTCKLSSAGKSWOE-DCHTUSCLSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|