C24H28ClN3O3 — CID 67964881
ethyl (2S)-1-[3-[1-[(4-chlorophenyl)methyl]indazol-3-yl]oxypropyl]pyrrolidine-2-carboxylate (PubChem CID 67964881) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is ethyl (2S)-1-[3-[1-[(4-chlorophenyl)methyl]indazol-3-yl]oxypropyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[3-[1-[(4-chlorophenyl)methyl]indazol-3-yl]oxypropyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67964881 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | ethyl (2S)-1-[3-[1-[(4-chlorophenyl)methyl]indazol-3-yl]oxypropyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1CCCOc1nn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H28ClN3O3/c1-2-30-24(29)22-9-5-14-27(22)15-6-16-31-23-20-7-3-4-8-21(20)28(26-23)17-18-10-12-19(25)13-11-18/h3-4,7-8,10-13,22H,2,5-6,9,14-17H2,1H3/t22-/m0/s1 |
| InChIKey | UZECDJRQGCBQOF-QFIPXVFZSA-N |
| XLogP | 4.53 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|