C30H35ClN4O — CID 77439778
N-benzyl-1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]indazol-5-amine (PubChem CID 77439778) has the molecular formula C30H35ClN4O and a molecular weight of 503.09 g/mol. Its IUPAC name is N-benzyl-1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]indazol-5-amine.
| Compound Name | N-benzyl-1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]indazol-5-amine |
|---|---|
| PubChem CID | 77439778 |
| Molecular Formula | C30H35ClN4O |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-benzyl-1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]indazol-5-amine |
| SMILES | CC1CCCN1CCCOc1nn(Cc2ccc(Cl)cc2)c2ccc(N(C)Cc3ccccc3)cc12 |
| InChI | InChI=1S/C30H35ClN4O/c1-23-8-6-17-34(23)18-7-19-36-30-28-20-27(33(2)21-24-9-4-3-5-10-24)15-16-29(28)35(32-30)22-25-11-13-26(31)14-12-25/h3-5,9-16,20,23H,6-8,17-19,21-22H2,1-2H3 |
| InChIKey | HYOKHTFXDLYPNN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|