C21H22Cl2FN3O — CID 70852749
5-chloro-1-[(4-chlorophenyl)methyl]-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propoxy]indazole (PubChem CID 70852749) has the molecular formula C21H22Cl2FN3O and a molecular weight of 422.33 g/mol. Its IUPAC name is 5-chloro-1-[(4-chlorophenyl)methyl]-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propoxy]indazole.
| Compound Name | 5-chloro-1-[(4-chlorophenyl)methyl]-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propoxy]indazole |
|---|---|
| PubChem CID | 70852749 |
| Molecular Formula | C21H22Cl2FN3O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 5-chloro-1-[(4-chlorophenyl)methyl]-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propoxy]indazole |
| SMILES | F[C@H]1CCN(CCCOc2nn(Cc3ccc(Cl)cc3)c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C21H22Cl2FN3O/c22-16-4-2-15(3-5-16)13-27-20-7-6-17(23)12-19(20)21(25-27)28-11-1-9-26-10-8-18(24)14-26/h2-7,12,18H,1,8-11,13-14H2/t18-/m0/s1 |
| InChIKey | INLNFOPLECXJTQ-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|