C26H27N3O6 — CID 67969169
tert-butyl 3-[(6S,11aS)-8,9-dihydroxy-2-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-6-yl]indole-1-carboxylate (PubChem CID 67969169) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is tert-butyl 3-[(6S,11aS)-8,9-dihydroxy-2-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-6-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(6S,11aS)-8,9-dihydroxy-2-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-6-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 67969169 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | tert-butyl 3-[(6S,11aS)-8,9-dihydroxy-2-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-6-yl]indole-1-carboxylate |
| SMILES | CN1CC(=O)N2[C@H](c3cn(C(=O)OC(C)(C)C)c4ccccc34)c3cc(O)c(O)cc3C[C@H]2C1=O |
| InChI | InChI=1S/C26H27N3O6/c1-26(2,3)35-25(34)28-12-17(15-7-5-6-8-18(15)28)23-16-11-21(31)20(30)10-14(16)9-19-24(33)27(4)13-22(32)29(19)23/h5-8,10-12,19,23,30-31H,9,13H2,1-4H3/t19-,23-/m0/s1 |
| InChIKey | LENSQVXMRCTDFL-CVDCTZTESA-N |
| XLogP | 3.15 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|