C11H20N6O2 — CID 67972343
tert-butyl 4-(2H-tetrazol-5-ylmethyl)piperazine-1-carboxylate (PubChem CID 67972343) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is tert-butyl 4-(2H-tetrazol-5-ylmethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2H-tetrazol-5-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67972343 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | tert-butyl 4-(2H-tetrazol-5-ylmethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2nn[nH]n2)CC1 |
| InChI | InChI=1S/C11H20N6O2/c1-11(2,3)19-10(18)17-6-4-16(5-7-17)8-9-12-14-15-13-9/h4-8H2,1-3H3,(H,12,13,14,15) |
| InChIKey | FMAGTKGXEWBMFR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |