C23H30N4O2 — CID 67973389
7-methoxy-2,3-dimethyl-1H-indol-4-amine;7-methoxy-1,2,3-trimethylindol-4-amine (PubChem CID 67973389) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 7-methoxy-2,3-dimethyl-1H-indol-4-amine;7-methoxy-1,2,3-trimethylindol-4-amine.
| Compound Name | 7-methoxy-2,3-dimethyl-1H-indol-4-amine;7-methoxy-1,2,3-trimethylindol-4-amine |
|---|---|
| PubChem CID | 67973389 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 7-methoxy-2,3-dimethyl-1H-indol-4-amine;7-methoxy-1,2,3-trimethylindol-4-amine |
| SMILES | COc1ccc(N)c2c(C)c(C)[nH]c12.COc1ccc(N)c2c(C)c(C)n(C)c12 |
| InChI | InChI=1S/C12H16N2O.C11H14N2O/c1-7-8(2)14(3)12-10(15-4)6-5-9(13)11(7)12;1-6-7(2)13-11-9(14-3)5-4-8(12)10(6)11/h5-6H,13H2,1-4H3;4-5,13H,12H2,1-3H3 |
| InChIKey | LPQAWONFSXBJSX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|