C20H18N6 — CID 67987247
3-[2,2-dipyridin-3-yl-1-(triazol-1-yl)ethyl]aniline (PubChem CID 67987247) has the molecular formula C20H18N6 and a molecular weight of 342.41 g/mol. Its IUPAC name is 3-[2,2-dipyridin-3-yl-1-(triazol-1-yl)ethyl]aniline.
| Compound Name | 3-[2,2-dipyridin-3-yl-1-(triazol-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 67987247 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[2,2-dipyridin-3-yl-1-(triazol-1-yl)ethyl]aniline |
| SMILES | Nc1cccc(C(C(c2cccnc2)c2cccnc2)n2ccnn2)c1 |
| InChI | InChI=1S/C20H18N6/c21-18-7-1-4-15(12-18)20(26-11-10-24-25-26)19(16-5-2-8-22-13-16)17-6-3-9-23-14-17/h1-14,19-20H,21H2 |
| InChIKey | DZGCJIMRUCTLHK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|