C21H27N3O2 — CID 67990354
(6aS,7S,10aR)-2-tert-butyl-4-ethoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 67990354) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (6aS,7S,10aR)-2-tert-butyl-4-ethoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7S,10aR)-2-tert-butyl-4-ethoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 67990354 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (6aS,7S,10aR)-2-tert-butyl-4-ethoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | CCOc1nc(C(C)(C)C)nc2c1CC[C@H]1[C@H](C)C(=O)C(C#N)=C[C@]21C |
| InChI | InChI=1S/C21H27N3O2/c1-7-26-18-14-8-9-15-12(2)16(25)13(11-22)10-21(15,6)17(14)23-19(24-18)20(3,4)5/h10,12,15H,7-9H2,1-6H3/t12-,15-,21-/m0/s1 |
| InChIKey | LJSYSOMJPNEPOX-QOKQMOMRSA-N |
| XLogP | 3.66 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |