C27H27N3O2 — CID 135132039
(6aR,7R,10aS)-4-[4-(hydroxymethyl)phenyl]-7,10a-dimethyl-8-oxo-2-[(3E)-penta-1,3-dien-3-yl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135132039) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-[4-(hydroxymethyl)phenyl]-7,10a-dimethyl-8-oxo-2-[(3E)-penta-1,3-dien-3-yl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-[4-(hydroxymethyl)phenyl]-7,10a-dimethyl-8-oxo-2-[(3E)-penta-1,3-dien-3-yl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135132039 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (6aR,7R,10aS)-4-[4-(hydroxymethyl)phenyl]-7,10a-dimethyl-8-oxo-2-[(3E)-penta-1,3-dien-3-yl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C=C/C(=C\C)c1nc(-c2ccc(CO)cc2)c2c(n1)[C@]1(C)C=C(C#N)C(=O)[C@H](C)[C@H]1CC2 |
| InChI | InChI=1S/C27H27N3O2/c1-5-18(6-2)26-29-23(19-9-7-17(15-31)8-10-19)21-11-12-22-16(3)24(32)20(14-28)13-27(22,4)25(21)30-26/h5-10,13,16,22,31H,1,11-12,15H2,2-4H3/b18-6+/t16-,22-,27-/m1/s1 |
| InChIKey | LXIGIDCJWFLTIN-DTLJEJGMSA-N |
| XLogP | 4.71 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|